C32H30N2O2 — CID 163509248
methyl (2R)-3-anilino-2-(1,5-dimethylindol-3-yl)-2,3-diphenylpropanoate (PubChem CID 163509248) has the molecular formula C32H30N2O2 and a molecular weight of 474.60 g/mol. Its IUPAC name is methyl (2R)-3-anilino-2-(1,5-dimethylindol-3-yl)-2,3-diphenylpropanoate.
| Compound Name | methyl (2R)-3-anilino-2-(1,5-dimethylindol-3-yl)-2,3-diphenylpropanoate |
|---|---|
| PubChem CID | 163509248 |
| Molecular Formula | C32H30N2O2 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | methyl (2R)-3-anilino-2-(1,5-dimethylindol-3-yl)-2,3-diphenylpropanoate |
| SMILES | COC(=O)[C@](c1ccccc1)(c1cn(C)c2ccc(C)cc12)C(Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H30N2O2/c1-23-19-20-29-27(21-23)28(22-34(29)2)32(31(35)36-3,25-15-9-5-10-16-25)30(24-13-7-4-8-14-24)33-26-17-11-6-12-18-26/h4-22,30,33H,1-3H3/t30?,32-/m1/s1 |
| InChIKey | DBGJEXVYOWVMKC-BDJZEIKTSA-N |
| XLogP | 6.80 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |