C19H23NO3 — CID 101139046
methyl (3R)-3-(2-hydroxy-5-methylanilino)-2,2-dimethyl-3-phenylpropanoate (PubChem CID 101139046) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is methyl (3R)-3-(2-hydroxy-5-methylanilino)-2,2-dimethyl-3-phenylpropanoate.
| Compound Name | methyl (3R)-3-(2-hydroxy-5-methylanilino)-2,2-dimethyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 101139046 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | methyl (3R)-3-(2-hydroxy-5-methylanilino)-2,2-dimethyl-3-phenylpropanoate |
| SMILES | COC(=O)C(C)(C)[C@H](Nc1cc(C)ccc1O)c1ccccc1 |
| InChI | InChI=1S/C19H23NO3/c1-13-10-11-16(21)15(12-13)20-17(14-8-6-5-7-9-14)19(2,3)18(22)23-4/h5-12,17,20-21H,1-4H3/t17-/m1/s1 |
| InChIKey | JCZDUUODDMPIOH-QGZVFWFLSA-N |
| XLogP | 4.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|