C15H13BrF3N — CID 82757456
2-bromo-5-methyl-N-(2,2,2-trifluoro-1-phenylethyl)aniline (PubChem CID 82757456) has the molecular formula C15H13BrF3N and a molecular weight of 344.17 g/mol. Its IUPAC name is 2-bromo-5-methyl-N-(2,2,2-trifluoro-1-phenylethyl)aniline.
| Compound Name | 2-bromo-5-methyl-N-(2,2,2-trifluoro-1-phenylethyl)aniline |
|---|---|
| PubChem CID | 82757456 |
| Molecular Formula | C15H13BrF3N |
| Molecular Weight | 344.17 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-bromo-5-methyl-N-(2,2,2-trifluoro-1-phenylethyl)aniline |
| SMILES | Cc1ccc(Br)c(NC(c2ccccc2)C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13BrF3N/c1-10-7-8-12(16)13(9-10)20-14(15(17,18)19)11-5-3-2-4-6-11/h2-9,14,20H,1H3 |
| InChIKey | XEIOECQXTLBKRI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.17 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |