C57H51BN2S2 — CID 132601164
[7-(3-phenothiazin-10-ylphenyl)-10-(2,4,6-trimethylphenyl)phenothiazin-3-yl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 132601164) has the molecular formula C57H51BN2S2 and a molecular weight of 839.00 g/mol. Its IUPAC name is [7-(3-phenothiazin-10-ylphenyl)-10-(2,4,6-trimethylphenyl)phenothiazin-3-yl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [7-(3-phenothiazin-10-ylphenyl)-10-(2,4,6-trimethylphenyl)phenothiazin-3-yl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 132601164 |
| Molecular Formula | C57H51BN2S2 |
| Molecular Weight | 839.00 g/mol |
| Exact Mass | 838.36 |
| IUPAC Name | [7-(3-phenothiazin-10-ylphenyl)-10-(2,4,6-trimethylphenyl)phenothiazin-3-yl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc3c(c2)Sc2cc(-c4cccc(N5c6ccccc6Sc6ccccc65)c4)ccc2N3c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C57H51BN2S2/c1-34-25-37(4)55(38(5)26-34)58(56-39(6)27-35(2)28-40(56)7)45-22-24-50-54(33-45)62-53-32-44(21-23-49(53)60(50)57-41(8)29-36(3)30-42(57)9)43-15-14-16-46(31-43)59-47-17-10-12-19-51(47)61-52-20-13-11-18-48(52)59/h10-33H,1-9H3 |
| InChIKey | GLXOAYJXUMPMBJ-UHFFFAOYSA-N |
| XLogP | 14.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.00 |
| LogP ≤ 5 | 14.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|