C52H52B2S — CID 140727606
[5-bis(2,4,6-trimethylphenyl)boranyl-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaen-14-yl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 140727606) has the molecular formula C52H52B2S and a molecular weight of 730.68 g/mol. Its IUPAC name is [5-bis(2,4,6-trimethylphenyl)boranyl-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaen-14-yl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [5-bis(2,4,6-trimethylphenyl)boranyl-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaen-14-yl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 140727606 |
| Molecular Formula | C52H52B2S |
| Molecular Weight | 730.68 g/mol |
| Exact Mass | 730.40 |
| IUPAC Name | [5-bis(2,4,6-trimethylphenyl)boranyl-8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaen-14-yl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc3c(c2)Sc2cccc4c(B(c5c(C)cc(C)cc5C)c5c(C)cc(C)cc5C)ccc-3c24)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C52H52B2S/c1-29-20-33(5)49(34(6)21-29)53(50-35(7)22-30(2)23-36(50)8)41-16-17-42-43-18-19-45(44-14-13-15-46(48(43)44)55-47(42)28-41)54(51-37(9)24-31(3)25-38(51)10)52-39(11)26-32(4)27-40(52)12/h13-28H,1-12H3 |
| InChIKey | BLGCDPQLWPMYJF-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.68 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|