C54H58B2Si — CID 140727613
[5-bis(2,4,6-trimethylphenyl)boranyl-8,8-dimethyl-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaen-14-yl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 140727613) has the molecular formula C54H58B2Si and a molecular weight of 756.77 g/mol. Its IUPAC name is [5-bis(2,4,6-trimethylphenyl)boranyl-8,8-dimethyl-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaen-14-yl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [5-bis(2,4,6-trimethylphenyl)boranyl-8,8-dimethyl-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaen-14-yl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 140727613 |
| Molecular Formula | C54H58B2Si |
| Molecular Weight | 756.77 g/mol |
| Exact Mass | 756.45 |
| IUPAC Name | [5-bis(2,4,6-trimethylphenyl)boranyl-8,8-dimethyl-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaen-14-yl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc3c(c2)[Si](C)(C)c2cccc4c(B(c5c(C)cc(C)cc5C)c5c(C)cc(C)cc5C)ccc-3c24)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C54H58B2Si/c1-31-22-35(5)51(36(6)23-31)55(52-37(7)24-32(2)25-38(52)8)43-18-19-44-45-20-21-47(46-16-15-17-48(50(45)46)57(13,14)49(44)30-43)56(53-39(9)26-33(3)27-40(53)10)54-41(11)28-34(4)29-42(54)12/h15-30H,1-14H3 |
| InChIKey | NYJWHOHGTAVJJM-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.77 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|