C58H66B2Si — CID 140727475
[5-bis(4-tert-butylphenyl)boranyl-8,8-dimethyl-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaen-14-yl]-bis(4-tert-butylphenyl)borane (PubChem CID 140727475) has the molecular formula C58H66B2Si and a molecular weight of 812.88 g/mol. Its IUPAC name is [5-bis(4-tert-butylphenyl)boranyl-8,8-dimethyl-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaen-14-yl]-bis(4-tert-butylphenyl)borane.
| Compound Name | [5-bis(4-tert-butylphenyl)boranyl-8,8-dimethyl-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaen-14-yl]-bis(4-tert-butylphenyl)borane |
|---|---|
| PubChem CID | 140727475 |
| Molecular Formula | C58H66B2Si |
| Molecular Weight | 812.88 g/mol |
| Exact Mass | 812.51 |
| IUPAC Name | [5-bis(4-tert-butylphenyl)boranyl-8,8-dimethyl-8-silatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,9,11,13,15-octaen-14-yl]-bis(4-tert-butylphenyl)borane |
| SMILES | CC(C)(C)c1ccc(B(c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)[Si](C)(C)c2cccc4c(B(c5ccc(C(C)(C)C)cc5)c5ccc(C(C)(C)C)cc5)ccc-3c24)cc1 |
| InChI | InChI=1S/C58H66B2Si/c1-55(2,3)39-18-26-43(27-19-39)59(44-28-20-40(21-29-44)56(4,5)6)47-34-35-48-49-36-37-51(50-16-15-17-52(54(49)50)61(13,14)53(48)38-47)60(45-30-22-41(23-31-45)57(7,8)9)46-32-24-42(25-33-46)58(10,11)12/h15-38H,1-14H3 |
| InChIKey | AHCKFAJSFXFRNU-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.88 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|