C42H39BO — CID 140727622
bis(4-tert-butylphenyl)-[4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-14-yl)phenyl]borane (PubChem CID 140727622) has the molecular formula C42H39BO and a molecular weight of 570.59 g/mol. Its IUPAC name is bis(4-tert-butylphenyl)-[4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-14-yl)phenyl]borane.
| Compound Name | bis(4-tert-butylphenyl)-[4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-14-yl)phenyl]borane |
|---|---|
| PubChem CID | 140727622 |
| Molecular Formula | C42H39BO |
| Molecular Weight | 570.59 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | bis(4-tert-butylphenyl)-[4-(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-14-yl)phenyl]borane |
| SMILES | CC(C)(C)c1ccc(B(c2ccc(-c3ccc4c5c(cccc35)Oc3ccccc3-4)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C42H39BO/c1-41(2,3)29-16-22-32(23-17-29)43(33-24-18-30(19-25-33)42(4,5)6)31-20-14-28(15-21-31)34-26-27-37-35-10-7-8-12-38(35)44-39-13-9-11-36(34)40(37)39/h7-27H,1-6H3 |
| InChIKey | WVJNYRGBSDAGEX-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.59 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|