C60H62B2S — CID 140727585
[5-bis(4-tert-butylphenyl)boranyl-8-thiapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-16-yl]-bis(4-tert-butylphenyl)borane (PubChem CID 140727585) has the molecular formula C60H62B2S and a molecular weight of 836.85 g/mol. Its IUPAC name is [5-bis(4-tert-butylphenyl)boranyl-8-thiapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-16-yl]-bis(4-tert-butylphenyl)borane.
| Compound Name | [5-bis(4-tert-butylphenyl)boranyl-8-thiapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-16-yl]-bis(4-tert-butylphenyl)borane |
|---|---|
| PubChem CID | 140727585 |
| Molecular Formula | C60H62B2S |
| Molecular Weight | 836.85 g/mol |
| Exact Mass | 836.48 |
| IUPAC Name | [5-bis(4-tert-butylphenyl)boranyl-8-thiapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-16-yl]-bis(4-tert-butylphenyl)borane |
| SMILES | CC(C)(C)c1ccc(B(c2ccc(C(C)(C)C)cc2)c2ccc3c(c2)Sc2cccc4c2c-3cc2ccc(B(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)cc24)cc1 |
| InChI | InChI=1S/C60H62B2S/c1-57(2,3)40-17-26-44(27-18-40)61(45-28-19-41(20-29-45)58(4,5)6)48-25-16-39-36-53-50-35-34-49(38-55(50)63-54-15-13-14-51(56(53)54)52(39)37-48)62(46-30-21-42(22-31-46)59(7,8)9)47-32-23-43(24-33-47)60(10,11)12/h13-38H,1-12H3 |
| InChIKey | YANSTADPLHMMAH-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.85 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|