C36H20BF9O — CID 140727477
(4-tert-butyl-2,3,5,6-tetrafluorophenyl)-(8-oxapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaen-16-yl)-(2,3,4,5,6-pentafluorophenyl)borane (PubChem CID 140727477) has the molecular formula C36H20BF9O and a molecular weight of 650.35 g/mol. Its IUPAC name is (4-tert-butyl-2,3,5,6-tetrafluorophenyl)-(8-oxapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaen-16-yl)-(2,3,4,5,6-pentafluorophenyl)borane.
| Compound Name | (4-tert-butyl-2,3,5,6-tetrafluorophenyl)-(8-oxapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaen-16-yl)-(2,3,4,5,6-pentafluorophenyl)borane |
|---|---|
| PubChem CID | 140727477 |
| Molecular Formula | C36H20BF9O |
| Molecular Weight | 650.35 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | (4-tert-butyl-2,3,5,6-tetrafluorophenyl)-(8-oxapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaen-16-yl)-(2,3,4,5,6-pentafluorophenyl)borane |
| SMILES | CC(C)(C)c1c(F)c(F)c(B(c2ccc3cc4c5c(cccc5c3c2)Oc2ccccc2-4)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C36H20BF9O/c1-36(2,3)24-27(38)29(40)25(30(41)28(24)39)37(26-31(42)33(44)35(46)34(45)32(26)43)16-12-11-15-13-20-17-7-4-5-9-21(17)47-22-10-6-8-18(23(20)22)19(15)14-16/h4-14H,1-3H3 |
| InChIKey | XYDXRVUDKUTPHU-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.35 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|