C56H54B2S — CID 140727664
[5-bis(2,4,6-trimethylphenyl)boranyl-8-thiapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-16-yl]-bis(2,4,6-trimethylphenyl)borane (PubChem CID 140727664) has the molecular formula C56H54B2S and a molecular weight of 780.74 g/mol. Its IUPAC name is [5-bis(2,4,6-trimethylphenyl)boranyl-8-thiapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-16-yl]-bis(2,4,6-trimethylphenyl)borane.
| Compound Name | [5-bis(2,4,6-trimethylphenyl)boranyl-8-thiapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-16-yl]-bis(2,4,6-trimethylphenyl)borane |
|---|---|
| PubChem CID | 140727664 |
| Molecular Formula | C56H54B2S |
| Molecular Weight | 780.74 g/mol |
| Exact Mass | 780.41 |
| IUPAC Name | [5-bis(2,4,6-trimethylphenyl)boranyl-8-thiapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaen-16-yl]-bis(2,4,6-trimethylphenyl)borane |
| SMILES | Cc1cc(C)c(B(c2ccc3c(c2)Sc2cccc4c2c-3cc2ccc(B(c3c(C)cc(C)cc3C)c3c(C)cc(C)cc3C)cc24)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C56H54B2S/c1-31-20-35(5)53(36(6)21-31)57(54-37(7)22-32(2)23-38(54)8)44-17-16-43-28-49-46-19-18-45(30-51(46)59-50-15-13-14-47(52(49)50)48(43)29-44)58(55-39(9)24-33(3)25-40(55)10)56-41(11)26-34(4)27-42(56)12/h13-30H,1-12H3 |
| InChIKey | OQJLGHMPJJZOOA-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.74 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|