C16H18O8 — CID 132601591
methyl (2R,3R,3aR,5S,6aR)-2-(benzoyloxymethyl)-3,5-dihydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate (PubChem CID 132601591) has the molecular formula C16H18O8 and a molecular weight of 338.31 g/mol. Its IUPAC name is methyl (2R,3R,3aR,5S,6aR)-2-(benzoyloxymethyl)-3,5-dihydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate.
| Compound Name | methyl (2R,3R,3aR,5S,6aR)-2-(benzoyloxymethyl)-3,5-dihydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate |
|---|---|
| PubChem CID | 132601591 |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | methyl (2R,3R,3aR,5S,6aR)-2-(benzoyloxymethyl)-3,5-dihydroxy-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-carboxylate |
| SMILES | COC(=O)[C@]1(O)C[C@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C16H18O8/c1-21-15(19)16(20)7-10-13(24-16)12(17)11(23-10)8-22-14(18)9-5-3-2-4-6-9/h2-6,10-13,17,20H,7-8H2,1H3/t10-,11-,12-,13+,16+/m1/s1 |
| InChIKey | ADSRGUFDIOAAEM-MXOJCPGVSA-N |
| XLogP | -0.38 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |