C19H24O8 — CID 57333160
butyl (1S,3R,5R,7R,8S)-7-(benzoyloxymethyl)-3,8-dihydroxy-2,6-dioxabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 57333160) has the molecular formula C19H24O8 and a molecular weight of 380.39 g/mol. Its IUPAC name is butyl (1S,3R,5R,7R,8S)-7-(benzoyloxymethyl)-3,8-dihydroxy-2,6-dioxabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | butyl (1S,3R,5R,7R,8S)-7-(benzoyloxymethyl)-3,8-dihydroxy-2,6-dioxabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 57333160 |
| Molecular Formula | C19H24O8 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | butyl (1S,3R,5R,7R,8S)-7-(benzoyloxymethyl)-3,8-dihydroxy-2,6-dioxabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CCCCOC(=O)[C@@]1(O)C[C@H]2O[C@H](COC(=O)c3ccccc3)[C@@H](O1)[C@H]2O |
| InChI | InChI=1S/C19H24O8/c1-2-3-9-24-18(22)19(23)10-13-15(20)16(27-19)14(26-13)11-25-17(21)12-7-5-4-6-8-12/h4-8,13-16,20,23H,2-3,9-11H2,1H3/t13-,14-,15+,16-,19-/m1/s1 |
| InChIKey | BGDMQEYSPNKXHV-RUEZSYAVSA-N |
| XLogP | 0.79 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|