C21H26O8 — CID 76513938
butyl 3,8-dihydroxy-7-(3-phenylprop-2-enoyloxymethyl)-2,6-dioxabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 76513938) has the molecular formula C21H26O8 and a molecular weight of 406.43 g/mol. Its IUPAC name is butyl 3,8-dihydroxy-7-(3-phenylprop-2-enoyloxymethyl)-2,6-dioxabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | butyl 3,8-dihydroxy-7-(3-phenylprop-2-enoyloxymethyl)-2,6-dioxabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 76513938 |
| Molecular Formula | C21H26O8 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | butyl 3,8-dihydroxy-7-(3-phenylprop-2-enoyloxymethyl)-2,6-dioxabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CCCCOC(=O)C1(O)CC2OC(COC(=O)C=Cc3ccccc3)C(O1)C2O |
| InChI | InChI=1S/C21H26O8/c1-2-3-11-26-20(24)21(25)12-15-18(23)19(29-21)16(28-15)13-27-17(22)10-9-14-7-5-4-6-8-14/h4-10,15-16,18-19,23,25H,2-3,11-13H2,1H3 |
| InChIKey | UPQCMLGSXKAYME-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|