C19H20N6O — CID 132601763
2-(4-piperazin-1-ylphenyl)-1,3,6,10-tetrazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-9-one (PubChem CID 132601763) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 2-(4-piperazin-1-ylphenyl)-1,3,6,10-tetrazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-9-one.
| Compound Name | 2-(4-piperazin-1-ylphenyl)-1,3,6,10-tetrazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-9-one |
|---|---|
| PubChem CID | 132601763 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-(4-piperazin-1-ylphenyl)-1,3,6,10-tetrazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-9-one |
| SMILES | O=C1NCCn2c(-c3ccc(N4CCNCC4)cc3)nc3cncc1c32 |
| InChI | InChI=1S/C19H20N6O/c26-19-15-11-21-12-16-17(15)25(10-7-22-19)18(23-16)13-1-3-14(4-2-13)24-8-5-20-6-9-24/h1-4,11-12,20H,5-10H2,(H,22,26) |
| InChIKey | OXPYBSCJVUBKOV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|