C28H45NO2 — CID 132602210
(3R)-3-[(2R)-2-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-1-methylpiperidin-2-one (PubChem CID 132602210) has the molecular formula C28H45NO2 and a molecular weight of 427.67 g/mol. Its IUPAC name is (3R)-3-[(2R)-2-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-1-methylpiperidin-2-one.
| Compound Name | (3R)-3-[(2R)-2-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-1-methylpiperidin-2-one |
|---|---|
| PubChem CID | 132602210 |
| Molecular Formula | C28H45NO2 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.35 |
| IUPAC Name | (3R)-3-[(2R)-2-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-1-methylpiperidin-2-one |
| SMILES | C[C@H](C[C@H]1CCCN(C)C1=O)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H45NO2/c1-18(16-19-6-5-15-29(4)26(19)31)23-9-10-24-22-8-7-20-17-21(30)11-13-27(20,2)25(22)12-14-28(23,24)3/h7,18-19,21-25,30H,5-6,8-17H2,1-4H3/t18-,19-,21+,22+,23-,24+,25+,27+,28-/m1/s1 |
| InChIKey | RMGSPNCVNICDCX-NELWDGDQSA-N |
| XLogP | 5.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|