C22H28F3NOSi — CID 132602503
2-methyl-6-(trifluoromethyl)-4-[2-tri(propan-2-yl)silylethynyl]isoquinolin-1-one (PubChem CID 132602503) has the molecular formula C22H28F3NOSi and a molecular weight of 407.55 g/mol. Its IUPAC name is 2-methyl-6-(trifluoromethyl)-4-[2-tri(propan-2-yl)silylethynyl]isoquinolin-1-one.
| Compound Name | 2-methyl-6-(trifluoromethyl)-4-[2-tri(propan-2-yl)silylethynyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 132602503 |
| Molecular Formula | C22H28F3NOSi |
| Molecular Weight | 407.55 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-methyl-6-(trifluoromethyl)-4-[2-tri(propan-2-yl)silylethynyl]isoquinolin-1-one |
| SMILES | CC(C)[Si](C#Cc1cn(C)c(=O)c2ccc(C(F)(F)F)cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H28F3NOSi/c1-14(2)28(15(3)4,16(5)6)11-10-17-13-26(7)21(27)19-9-8-18(12-20(17)19)22(23,24)25/h8-9,12-16H,1-7H3 |
| InChIKey | WXNLHGLUIQWJCQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.55 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|