C9H7N3 — CID 132602686
2-pyrrolo[2,3-c]pyridin-6-ylacetonitrile (PubChem CID 132602686) has the molecular formula C9H7N3 and a molecular weight of 157.18 g/mol. Its IUPAC name is 2-pyrrolo[2,3-c]pyridin-6-ylacetonitrile.
| Compound Name | 2-pyrrolo[2,3-c]pyridin-6-ylacetonitrile |
|---|---|
| PubChem CID | 132602686 |
| Molecular Formula | C9H7N3 |
| Molecular Weight | 157.18 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 2-pyrrolo[2,3-c]pyridin-6-ylacetonitrile |
| SMILES | N#CCn1ccc2ccnc-2c1 |
| InChI | InChI=1S/C9H7N3/c10-3-6-12-5-2-8-1-4-11-9(8)7-12/h1-2,4-5,7H,6H2 |
| InChIKey | QEDWMSFDNLEDGE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |