C24H30O6 — CID 132606804
(4aR,6R,7R,8R,8aR)-2-phenyl-6-undeca-2,4-diynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 132606804) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (4aR,6R,7R,8R,8aR)-2-phenyl-6-undeca-2,4-diynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6R,7R,8R,8aR)-2-phenyl-6-undeca-2,4-diynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 132606804 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (4aR,6R,7R,8R,8aR)-2-phenyl-6-undeca-2,4-diynoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | CCCCCCC#CC#CCO[C@@H]1O[C@@H]2COC(c3ccccc3)O[C@@H]2[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H30O6/c1-2-3-4-5-6-7-8-9-13-16-27-24-21(26)20(25)22-19(29-24)17-28-23(30-22)18-14-11-10-12-15-18/h10-12,14-15,19-26H,2-6,16-17H2,1H3/t19-,20-,21-,22+,23?,24-/m1/s1 |
| InChIKey | JCGORXGDWFYZSV-XTWNYSIHSA-N |
| XLogP | 2.54 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|