C23H19NO2 — CID 132607709
3-methyl-3-phenacyl-5-phenyl-2H-isoindol-1-one (PubChem CID 132607709) has the molecular formula C23H19NO2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-methyl-3-phenacyl-5-phenyl-2H-isoindol-1-one.
| Compound Name | 3-methyl-3-phenacyl-5-phenyl-2H-isoindol-1-one |
|---|---|
| PubChem CID | 132607709 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3-methyl-3-phenacyl-5-phenyl-2H-isoindol-1-one |
| SMILES | CC1(CC(=O)c2ccccc2)NC(=O)c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C23H19NO2/c1-23(15-21(25)17-10-6-3-7-11-17)20-14-18(16-8-4-2-5-9-16)12-13-19(20)22(26)24-23/h2-14H,15H2,1H3,(H,24,26) |
| InChIKey | KRKLSJBZFQIJBL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |