C18H19BrN2O4 — CID 132608255
diethyl 1-[(4-bromophenyl)iminomethyl]-5-methylpyrrole-2,4-dicarboxylate (PubChem CID 132608255) has the molecular formula C18H19BrN2O4 and a molecular weight of 407.26 g/mol. Its IUPAC name is diethyl 1-[(4-bromophenyl)iminomethyl]-5-methylpyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 1-[(4-bromophenyl)iminomethyl]-5-methylpyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 132608255 |
| Molecular Formula | C18H19BrN2O4 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | diethyl 1-[(4-bromophenyl)iminomethyl]-5-methylpyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)n(/C=N/c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C18H19BrN2O4/c1-4-24-17(22)15-10-16(18(23)25-5-2)21(12(15)3)11-20-14-8-6-13(19)7-9-14/h6-11H,4-5H2,1-3H3/b20-11+ |
| InChIKey | WMTNURXJEZATKY-RGVLZGJSSA-N |
| XLogP | 4.12 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|