C17H18N2O2 — CID 132608679
6-(2-nitro-1-phenylethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 132608679) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 6-(2-nitro-1-phenylethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-(2-nitro-1-phenylethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 132608679 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 6-(2-nitro-1-phenylethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | O=[N+]([O-])CC(c1ccccc1)c1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C17H18N2O2/c20-19(21)12-16(13-5-2-1-3-6-13)14-8-9-17-15(11-14)7-4-10-18-17/h1-3,5-6,8-9,11,16,18H,4,7,10,12H2 |
| InChIKey | HXUQAFUZNAGJEJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|