C18H20N2O2 — CID 134851605
6-[(1S)-1-(4-methylphenyl)-2-nitroethyl]-1,2,3,4-tetrahydroquinoline (PubChem CID 134851605) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 6-[(1S)-1-(4-methylphenyl)-2-nitroethyl]-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-[(1S)-1-(4-methylphenyl)-2-nitroethyl]-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 134851605 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 6-[(1S)-1-(4-methylphenyl)-2-nitroethyl]-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1ccc([C@H](C[N+](=O)[O-])c2ccc3c(c2)CCCN3)cc1 |
| InChI | InChI=1S/C18H20N2O2/c1-13-4-6-14(7-5-13)17(12-20(21)22)15-8-9-18-16(11-15)3-2-10-19-18/h4-9,11,17,19H,2-3,10,12H2,1H3/t17-/m0/s1 |
| InChIKey | VNMRHEUNUDGRFL-KRWDZBQOSA-N |
| XLogP | 3.76 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|