C17H20N2O2S — CID 175307098
(4-methylphenyl)-(1,2,3,4-tetrahydroquinolin-6-yl)methanesulfonamide (PubChem CID 175307098) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is (4-methylphenyl)-(1,2,3,4-tetrahydroquinolin-6-yl)methanesulfonamide.
| Compound Name | (4-methylphenyl)-(1,2,3,4-tetrahydroquinolin-6-yl)methanesulfonamide |
|---|---|
| PubChem CID | 175307098 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (4-methylphenyl)-(1,2,3,4-tetrahydroquinolin-6-yl)methanesulfonamide |
| SMILES | Cc1ccc(C(c2ccc3c(c2)CCCN3)S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H20N2O2S/c1-12-4-6-13(7-5-12)17(22(18,20)21)15-8-9-16-14(11-15)3-2-10-19-16/h4-9,11,17,19H,2-3,10H2,1H3,(H2,18,20,21) |
| InChIKey | NIGRYQGOLXWWQY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |