C46H38N4O8 — CID 13261300
1,10-bis[(2E)-2-(1-acetyl-3-oxoindol-2-ylidene)-3-oxoindol-1-yl]decane-1,10-dione (PubChem CID 13261300) has the molecular formula C46H38N4O8 and a molecular weight of 774.83 g/mol. Its IUPAC name is 1,10-bis[(2E)-2-(1-acetyl-3-oxoindol-2-ylidene)-3-oxoindol-1-yl]decane-1,10-dione.
| Compound Name | 1,10-bis[(2E)-2-(1-acetyl-3-oxoindol-2-ylidene)-3-oxoindol-1-yl]decane-1,10-dione |
|---|---|
| PubChem CID | 13261300 |
| Molecular Formula | C46H38N4O8 |
| Molecular Weight | 774.83 g/mol |
| Exact Mass | 774.27 |
| IUPAC Name | 1,10-bis[(2E)-2-(1-acetyl-3-oxoindol-2-ylidene)-3-oxoindol-1-yl]decane-1,10-dione |
| SMILES | CC(=O)N1/C(=C2\C(=O)c3ccccc3N2C(=O)CCCCCCCCC(=O)N2/C(=C3\C(=O)c4ccccc4N3C(C)=O)C(=O)c3ccccc32)C(=O)c2ccccc21 |
| InChI | InChI=1S/C46H38N4O8/c1-27(51)47-33-21-13-9-17-29(33)43(55)39(47)41-45(57)31-19-11-15-23-35(31)49(41)37(53)25-7-5-3-4-6-8-26-38(54)50-36-24-16-12-20-32(36)46(58)42(50)40-44(56)30-18-10-14-22-34(30)48(40)28(2)52/h9-24H,3-8,25-26H2,1-2H3/b41-39+,42-40+ |
| InChIKey | LPYRRPSEIXPUCV-LMXNTIJMSA-N |
| XLogP | 7.49 |
| TPSA | 149.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.83 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_E(44)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|