C25H32N2O2 — CID 132659686
4-methoxy-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]-3-prop-2-enylbenzamide (PubChem CID 132659686) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 4-methoxy-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]-3-prop-2-enylbenzamide.
| Compound Name | 4-methoxy-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]-3-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 132659686 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 4-methoxy-N-[1-[4-(3-methylpiperidin-1-yl)phenyl]ethyl]-3-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NC(C)c2ccc(N3CCCC(C)C3)cc2)ccc1OC |
| InChI | InChI=1S/C25H32N2O2/c1-5-7-21-16-22(11-14-24(21)29-4)25(28)26-19(3)20-9-12-23(13-10-20)27-15-6-8-18(2)17-27/h5,9-14,16,18-19H,1,6-8,15,17H2,2-4H3,(H,26,28) |
| InChIKey | WOHPAJTZOPBLTE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|