C22H27ClN2O2S — CID 132665924
2-(4-chlorophenyl)sulfanyl-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]butanamide (PubChem CID 132665924) has the molecular formula C22H27ClN2O2S and a molecular weight of 418.99 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]butanamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]butanamide |
|---|---|
| PubChem CID | 132665924 |
| Molecular Formula | C22H27ClN2O2S |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[4-(1-methylpiperidin-4-yl)oxyphenyl]butanamide |
| SMILES | CCC(Sc1ccc(Cl)cc1)C(=O)Nc1ccc(OC2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C22H27ClN2O2S/c1-3-21(28-20-10-4-16(23)5-11-20)22(26)24-17-6-8-18(9-7-17)27-19-12-14-25(2)15-13-19/h4-11,19,21H,3,12-15H2,1-2H3,(H,24,26) |
| InChIKey | WAUMQBCQUXXAQK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |