C9H16O2P+ — CID 13268675
hydroxy-oxo-(4,5,5-trimethylhexa-2,3-dien-2-yl)phosphanium (PubChem CID 13268675) has the molecular formula C9H16O2P+ and a molecular weight of 187.20 g/mol. Its IUPAC name is hydroxy-oxo-(4,5,5-trimethylhexa-2,3-dien-2-yl)phosphanium.
| Compound Name | hydroxy-oxo-(4,5,5-trimethylhexa-2,3-dien-2-yl)phosphanium |
|---|---|
| PubChem CID | 13268675 |
| Molecular Formula | C9H16O2P+ |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | hydroxy-oxo-(4,5,5-trimethylhexa-2,3-dien-2-yl)phosphanium |
| SMILES | CC(=C=C(C)C(C)(C)C)[P+](=O)O |
| InChI | InChI=1S/C9H15O2P/c1-7(9(3,4)5)6-8(2)12(10)11/h1-5H3/p+1 |
| InChIKey | OLZZPZUDVVIVIS-UHFFFAOYSA-O |
| XLogP | 3.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|