C18H30 — CID 24978404
3-tert-butyl-2,2,7,8,8-pentamethylnona-3,4,5,6-tetraene (PubChem CID 24978404) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 3-tert-butyl-2,2,7,8,8-pentamethylnona-3,4,5,6-tetraene.
| Compound Name | 3-tert-butyl-2,2,7,8,8-pentamethylnona-3,4,5,6-tetraene |
|---|---|
| PubChem CID | 24978404 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 3-tert-butyl-2,2,7,8,8-pentamethylnona-3,4,5,6-tetraene |
| SMILES | CC(=C=C=C=C(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H30/c1-14(16(2,3)4)12-11-13-15(17(5,6)7)18(8,9)10/h1-10H3 |
| InChIKey | YUQYXMSQSZETGR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |