C10H17LiO — CID 134987526
lithium (3E)-2,2,4,5-tetramethylhexa-3,5-dien-3-olate (PubChem CID 134987526) has the molecular formula C10H17LiO and a molecular weight of 160.19 g/mol. Its IUPAC name is lithium (3E)-2,2,4,5-tetramethylhexa-3,5-dien-3-olate.
| Compound Name | lithium (3E)-2,2,4,5-tetramethylhexa-3,5-dien-3-olate |
|---|---|
| PubChem CID | 134987526 |
| Molecular Formula | C10H17LiO |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | lithium (3E)-2,2,4,5-tetramethylhexa-3,5-dien-3-olate |
| SMILES | C=C(C)/C(C)=C(/[O-])C(C)(C)C.[Li+] |
| InChI | InChI=1S/C10H18O.Li/c1-7(2)8(3)9(11)10(4,5)6;/h11H,1H2,2-6H3;/q;+1/p-1/b9-8+; |
| InChIKey | MQAAOAQOFFAVIL-HRNDJLQDSA-M |
| XLogP | -0.75 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|