C7H14Si — CID 154334462
3,4-dimethylpenta-2,4-dien-2-ylsilane (PubChem CID 154334462) has the molecular formula C7H14Si and a molecular weight of 126.27 g/mol. Its IUPAC name is 3,4-dimethylpenta-2,4-dien-2-ylsilane.
| Compound Name | 3,4-dimethylpenta-2,4-dien-2-ylsilane |
|---|---|
| PubChem CID | 154334462 |
| Molecular Formula | C7H14Si |
| Molecular Weight | 126.27 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 3,4-dimethylpenta-2,4-dien-2-ylsilane |
| SMILES | C=C(C)C(C)=C(C)[SiH3] |
| InChI | InChI=1S/C7H14Si/c1-5(2)6(3)7(4)8/h1H2,2-4,8H3 |
| InChIKey | JMEOPOVMFBLTAZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|