C8H12W — CID 59085840
[(2Z)-2,3,4-trimethylpenta-2,4-dienylidene]tungsten (PubChem CID 59085840) has the molecular formula C8H12W and a molecular weight of 292.02 g/mol. Its IUPAC name is [(2Z)-2,3,4-trimethylpenta-2,4-dienylidene]tungsten.
| Compound Name | [(2Z)-2,3,4-trimethylpenta-2,4-dienylidene]tungsten |
|---|---|
| PubChem CID | 59085840 |
| Molecular Formula | C8H12W |
| Molecular Weight | 292.02 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | [(2Z)-2,3,4-trimethylpenta-2,4-dienylidene]tungsten |
| SMILES | C=C(C)/C(C)=C(/C)C=[W] |
| InChI | InChI=1S/C8H12.W/c1-6(2)8(5)7(3)4;/h1H,3H2,2,4-5H3;/b8-6+; |
| InChIKey | HBHUPWBXSAFUTR-WVLIHFOGSA-N |
| XLogP | 2.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.02 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|