C14H24 — CID 157075274
(3E)-2,3,4,5,5,6-hexamethylocta-1,3,6-triene (PubChem CID 157075274) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (3E)-2,3,4,5,5,6-hexamethylocta-1,3,6-triene.
| Compound Name | (3E)-2,3,4,5,5,6-hexamethylocta-1,3,6-triene |
|---|---|
| PubChem CID | 157075274 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (3E)-2,3,4,5,5,6-hexamethylocta-1,3,6-triene |
| SMILES | C=C(C)/C(C)=C(\C)C(C)(C)C(C)=CC |
| InChI | InChI=1S/C14H24/c1-9-11(4)14(7,8)13(6)12(5)10(2)3/h9H,2H2,1,3-8H3/b11-9?,13-12+ |
| InChIKey | ARWLAXRVQQEEMT-IAMQCISTSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|