C14H26 — CID 157253395
(3E)-3-tert-butyl-2,4,5,5-tetramethylhexa-1,3-diene (PubChem CID 157253395) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is (3E)-3-tert-butyl-2,4,5,5-tetramethylhexa-1,3-diene.
| Compound Name | (3E)-3-tert-butyl-2,4,5,5-tetramethylhexa-1,3-diene |
|---|---|
| PubChem CID | 157253395 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | (3E)-3-tert-butyl-2,4,5,5-tetramethylhexa-1,3-diene |
| SMILES | C=C(C)/C(=C(\C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H26/c1-10(2)12(14(7,8)9)11(3)13(4,5)6/h1H2,2-9H3/b12-11- |
| InChIKey | RADYGQPAYBVGAK-QXMHVHEDSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|