C12H23N — CID 138649011
(2Z)-3-tert-butyl-N,N,4-trimethylpenta-2,4-dien-2-amine (PubChem CID 138649011) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (2Z)-3-tert-butyl-N,N,4-trimethylpenta-2,4-dien-2-amine.
| Compound Name | (2Z)-3-tert-butyl-N,N,4-trimethylpenta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 138649011 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (2Z)-3-tert-butyl-N,N,4-trimethylpenta-2,4-dien-2-amine |
| SMILES | C=C(C)/C(=C(/C)N(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H23N/c1-9(2)11(12(4,5)6)10(3)13(7)8/h1H2,2-8H3/b11-10+ |
| InChIKey | WCFYCQQFMDJAHP-ZHACJKMWSA-N |
| XLogP | 3.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|