C11H23N — CID 162278721
2,2,4,5,5-pentamethylhex-3-en-3-amine (PubChem CID 162278721) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is 2,2,4,5,5-pentamethylhex-3-en-3-amine.
| Compound Name | 2,2,4,5,5-pentamethylhex-3-en-3-amine |
|---|---|
| PubChem CID | 162278721 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | 2,2,4,5,5-pentamethylhex-3-en-3-amine |
| SMILES | CC(=C(N)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H23N/c1-8(10(2,3)4)9(12)11(5,6)7/h12H2,1-7H3 |
| InChIKey | SHBKHDWQVXXCGU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |