C12H26N2 — CID 146578012
1-methyl-1-[(E)-2,2,4,5,5-pentamethylhex-3-en-3-yl]hydrazine (PubChem CID 146578012) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 1-methyl-1-[(E)-2,2,4,5,5-pentamethylhex-3-en-3-yl]hydrazine.
| Compound Name | 1-methyl-1-[(E)-2,2,4,5,5-pentamethylhex-3-en-3-yl]hydrazine |
|---|---|
| PubChem CID | 146578012 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 1-methyl-1-[(E)-2,2,4,5,5-pentamethylhex-3-en-3-yl]hydrazine |
| SMILES | C/C(=C(\N(C)N)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H26N2/c1-9(11(2,3)4)10(14(8)13)12(5,6)7/h13H2,1-8H3/b10-9+ |
| InChIKey | QCLPDUPMEULLBD-MDZDMXLPSA-N |
| XLogP | 3.16 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|