C18H39NP+ — CID 139298872
[tert-butyl-[(Z)-2,2,4,5,5-pentamethylhex-3-en-3-yl]amino]-trimethylphosphanium (PubChem CID 139298872) has the molecular formula C18H39NP+ and a molecular weight of 300.49 g/mol. Its IUPAC name is [tert-butyl-[(Z)-2,2,4,5,5-pentamethylhex-3-en-3-yl]amino]-trimethylphosphanium.
| Compound Name | [tert-butyl-[(Z)-2,2,4,5,5-pentamethylhex-3-en-3-yl]amino]-trimethylphosphanium |
|---|---|
| PubChem CID | 139298872 |
| Molecular Formula | C18H39NP+ |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.28 |
| IUPAC Name | [tert-butyl-[(Z)-2,2,4,5,5-pentamethylhex-3-en-3-yl]amino]-trimethylphosphanium |
| SMILES | C/C(=C(/N(C(C)(C)C)[P+](C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H39NP/c1-14(16(2,3)4)15(17(5,6)7)19(18(8,9)10)20(11,12)13/h1-13H3/q+1/b15-14- |
| InChIKey | AFKXBQJNFSGKKI-PFONDFGASA-N |
| XLogP | 6.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|