C14H28N2 — CID 166857373
1-[(3E,5Z)-4-tert-butyl-2,2-dimethylhepta-3,5-dien-3-yl]-1-methylhydrazine (PubChem CID 166857373) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 1-[(3E,5Z)-4-tert-butyl-2,2-dimethylhepta-3,5-dien-3-yl]-1-methylhydrazine.
| Compound Name | 1-[(3E,5Z)-4-tert-butyl-2,2-dimethylhepta-3,5-dien-3-yl]-1-methylhydrazine |
|---|---|
| PubChem CID | 166857373 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 1-[(3E,5Z)-4-tert-butyl-2,2-dimethylhepta-3,5-dien-3-yl]-1-methylhydrazine |
| SMILES | C/C=C\C(=C(/N(C)N)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28N2/c1-9-10-11(13(2,3)4)12(16(8)15)14(5,6)7/h9-10H,15H2,1-8H3/b10-9-,12-11+ |
| InChIKey | FSYLAGNJDGCVEN-XAZJVICWSA-N |
| XLogP | 3.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|