C11H26N4 — CID 171483557
3,4,4,5,5-pentamethylhex-2-ene-1,1,1,2-tetramine (PubChem CID 171483557) has the molecular formula C11H26N4 and a molecular weight of 214.36 g/mol. Its IUPAC name is 3,4,4,5,5-pentamethylhex-2-ene-1,1,1,2-tetramine.
| Compound Name | 3,4,4,5,5-pentamethylhex-2-ene-1,1,1,2-tetramine |
|---|---|
| PubChem CID | 171483557 |
| Molecular Formula | C11H26N4 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.22 |
| IUPAC Name | 3,4,4,5,5-pentamethylhex-2-ene-1,1,1,2-tetramine |
| SMILES | CC(=C(N)C(N)(N)N)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H26N4/c1-7(8(12)11(13,14)15)10(5,6)9(2,3)4/h12-15H2,1-6H3 |
| InChIKey | PUYWCQQILDWSMC-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|