C34H68 — CID 159350576
methane;(4Z,7Z,10Z)-2,2,3,3,4,5,6,6,7,8,9,9,10,11,12,12,13,13-octadecamethyltetradeca-4,7,10-triene (PubChem CID 159350576) has the molecular formula C34H68 and a molecular weight of 476.92 g/mol. Its IUPAC name is methane;(4Z,7Z,10Z)-2,2,3,3,4,5,6,6,7,8,9,9,10,11,12,12,13,13-octadecamethyltetradeca-4,7,10-triene.
| Compound Name | methane;(4Z,7Z,10Z)-2,2,3,3,4,5,6,6,7,8,9,9,10,11,12,12,13,13-octadecamethyltetradeca-4,7,10-triene |
|---|---|
| PubChem CID | 159350576 |
| Molecular Formula | C34H68 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.53 |
| IUPAC Name | methane;(4Z,7Z,10Z)-2,2,3,3,4,5,6,6,7,8,9,9,10,11,12,12,13,13-octadecamethyltetradeca-4,7,10-triene |
| SMILES | C.C.C/C(=C(\C)C(C)(C)/C(C)=C(/C)C(C)(C)C(C)(C)C)C(C)(C)/C(C)=C(/C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H60.2CH4/c1-21(29(13,14)23(3)25(5)31(17,18)27(7,8)9)22(2)30(15,16)24(4)26(6)32(19,20)28(10,11)12;;/h1-20H3;2*1H4/b22-21-,25-23-,26-24-;; |
| InChIKey | LHGUJWCYKSKDPR-PTRHJFLJSA-N |
| XLogP | 12.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|