C6H10O2P+ — CID 88854983
hydroxy-[(2Z)-4-methylpenta-2,4-dien-2-yl]-oxophosphanium (PubChem CID 88854983) has the molecular formula C6H10O2P+ and a molecular weight of 145.12 g/mol. Its IUPAC name is hydroxy-[(2Z)-4-methylpenta-2,4-dien-2-yl]-oxophosphanium.
| Compound Name | hydroxy-[(2Z)-4-methylpenta-2,4-dien-2-yl]-oxophosphanium |
|---|---|
| PubChem CID | 88854983 |
| Molecular Formula | C6H10O2P+ |
| Molecular Weight | 145.12 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | hydroxy-[(2Z)-4-methylpenta-2,4-dien-2-yl]-oxophosphanium |
| SMILES | C=C(C)/C=C(/C)[P+](=O)O |
| InChI | InChI=1S/C6H9O2P/c1-5(2)4-6(3)9(7)8/h4H,1H2,2-3H3/p+1/b6-4- |
| InChIKey | HGYWFEPJPLXIKB-XQRVVYSFSA-O |
| XLogP | 2.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.12 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|