C8H13NO2S2 — CID 13274670
methyl 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylate (PubChem CID 13274670) has the molecular formula C8H13NO2S2 and a molecular weight of 219.33 g/mol. Its IUPAC name is methyl 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylate.
| Compound Name | methyl 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylate |
|---|---|
| PubChem CID | 13274670 |
| Molecular Formula | C8H13NO2S2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | methyl 1,4-dithia-7-azaspiro[4.4]nonane-8-carboxylate |
| SMILES | COC(=O)C1CC2(CN1)SCCS2 |
| InChI | InChI=1S/C8H13NO2S2/c1-11-7(10)6-4-8(5-9-6)12-2-3-13-8/h6,9H,2-5H2,1H3 |
| InChIKey | LENTWHDOSMHLEE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |