C19H25N7O2S — CID 132766428
2-[[4-[1-(cyanomethyl)pyrrolidin-2-yl]pyrimidin-2-yl]amino]-N-(2-propan-2-yloxyethyl)-1,3-thiazole-4-carboxamide (PubChem CID 132766428) has the molecular formula C19H25N7O2S and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-[[4-[1-(cyanomethyl)pyrrolidin-2-yl]pyrimidin-2-yl]amino]-N-(2-propan-2-yloxyethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[4-[1-(cyanomethyl)pyrrolidin-2-yl]pyrimidin-2-yl]amino]-N-(2-propan-2-yloxyethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 132766428 |
| Molecular Formula | C19H25N7O2S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | 2-[[4-[1-(cyanomethyl)pyrrolidin-2-yl]pyrimidin-2-yl]amino]-N-(2-propan-2-yloxyethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)OCCNC(=O)c1csc(Nc2nccc(C3CCCN3CC#N)n2)n1 |
| InChI | InChI=1S/C19H25N7O2S/c1-13(2)28-11-8-21-17(27)15-12-29-19(24-15)25-18-22-7-5-14(23-18)16-4-3-9-26(16)10-6-20/h5,7,12-13,16H,3-4,8-11H2,1-2H3,(H,21,27)(H,22,23,24,25) |
| InChIKey | NMTZDTXKHXCYPL-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|