C19H24N8O2S — CID 132772288
2-[[4-[1-(cyanomethyl)piperidin-3-yl]pyrimidin-2-yl]amino]-N-morpholin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 132772288) has the molecular formula C19H24N8O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-[[4-[1-(cyanomethyl)piperidin-3-yl]pyrimidin-2-yl]amino]-N-morpholin-4-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[4-[1-(cyanomethyl)piperidin-3-yl]pyrimidin-2-yl]amino]-N-morpholin-4-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 132772288 |
| Molecular Formula | C19H24N8O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-[[4-[1-(cyanomethyl)piperidin-3-yl]pyrimidin-2-yl]amino]-N-morpholin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | N#CCN1CCCC(c2ccnc(Nc3nc(C(=O)NN4CCOCC4)cs3)n2)C1 |
| InChI | InChI=1S/C19H24N8O2S/c20-4-7-26-6-1-2-14(12-26)15-3-5-21-18(22-15)24-19-23-16(13-30-19)17(28)25-27-8-10-29-11-9-27/h3,5,13-14H,1-2,6-12H2,(H,25,28)(H,21,22,23,24) |
| InChIKey | ITHXRKVOMVBOLO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|