C18H20N6OS — CID 132771049
2-[[6-[1-(cyanomethyl)pyrrolidin-2-yl]-2-pyridinyl]amino]-N-cyclopropyl-1,3-thiazole-4-carboxamide (PubChem CID 132771049) has the molecular formula C18H20N6OS and a molecular weight of 368.47 g/mol. Its IUPAC name is 2-[[6-[1-(cyanomethyl)pyrrolidin-2-yl]-2-pyridinyl]amino]-N-cyclopropyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[6-[1-(cyanomethyl)pyrrolidin-2-yl]-2-pyridinyl]amino]-N-cyclopropyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 132771049 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[[6-[1-(cyanomethyl)pyrrolidin-2-yl]-2-pyridinyl]amino]-N-cyclopropyl-1,3-thiazole-4-carboxamide |
| SMILES | N#CCN1CCCC1c1cccc(Nc2nc(C(=O)NC3CC3)cs2)n1 |
| InChI | InChI=1S/C18H20N6OS/c19-8-10-24-9-2-4-15(24)13-3-1-5-16(21-13)23-18-22-14(11-26-18)17(25)20-12-6-7-12/h1,3,5,11-12,15H,2,4,6-7,9-10H2,(H,20,25)(H,21,22,23) |
| InChIKey | MQMCMUZQNBTTEC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|