C14H19FN2O4S — CID 132776872
2-[1-(2-fluorophenyl)sulfonyl-2-(methoxymethyl)pyrrolidin-2-yl]acetamide (PubChem CID 132776872) has the molecular formula C14H19FN2O4S and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)sulfonyl-2-(methoxymethyl)pyrrolidin-2-yl]acetamide.
| Compound Name | 2-[1-(2-fluorophenyl)sulfonyl-2-(methoxymethyl)pyrrolidin-2-yl]acetamide |
|---|---|
| PubChem CID | 132776872 |
| Molecular Formula | C14H19FN2O4S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[1-(2-fluorophenyl)sulfonyl-2-(methoxymethyl)pyrrolidin-2-yl]acetamide |
| SMILES | COCC1(CC(N)=O)CCCN1S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C14H19FN2O4S/c1-21-10-14(9-13(16)18)7-4-8-17(14)22(19,20)12-6-3-2-5-11(12)15/h2-3,5-6H,4,7-10H2,1H3,(H2,16,18) |
| InChIKey | KAPDLCOLRWKKAK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |