C10H16N2O — CID 13278097
6-butyl-2,4-dimethylpyridazin-3-one (PubChem CID 13278097) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 6-butyl-2,4-dimethylpyridazin-3-one.
| Compound Name | 6-butyl-2,4-dimethylpyridazin-3-one |
|---|---|
| PubChem CID | 13278097 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 6-butyl-2,4-dimethylpyridazin-3-one |
| SMILES | CCCCc1cc(C)c(=O)n(C)n1 |
| InChI | InChI=1S/C10H16N2O/c1-4-5-6-9-7-8(2)10(13)12(3)11-9/h7H,4-6H2,1-3H3 |
| InChIKey | PYKQSHRKJKGTLA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |