C15H11N5O3 — CID 132819228
9-(3-nitrophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 132819228) has the molecular formula C15H11N5O3 and a molecular weight of 309.28 g/mol. Its IUPAC name is 9-(3-nitrophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 9-(3-nitrophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 132819228 |
| Molecular Formula | C15H11N5O3 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 9-(3-nitrophenyl)-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1CCCc2nc3ncnn3c(-c3cccc([N+](=O)[O-])c3)c21 |
| InChI | InChI=1S/C15H11N5O3/c21-12-6-2-5-11-13(12)14(19-15(18-11)16-8-17-19)9-3-1-4-10(7-9)20(22)23/h1,3-4,7-8H,2,5-6H2 |
| InChIKey | OKMKCPHJSHIBFE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 103.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|