C13H7N7O3 — CID 66499017
11-(3-nitrophenyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66499017) has the molecular formula C13H7N7O3 and a molecular weight of 309.25 g/mol. Its IUPAC name is 11-(3-nitrophenyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-(3-nitrophenyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66499017 |
| Molecular Formula | C13H7N7O3 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 11-(3-nitrophenyl)-2,3,5,7,8,11-hexazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | O=c1c2nnc3ncnn3c2ccn1-c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H7N7O3/c21-12-11-10(19-13(17-16-11)14-7-15-19)4-5-18(12)8-2-1-3-9(6-8)20(22)23/h1-7H |
| InChIKey | UPHGXVKQXMEKME-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 121.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|